C24H29N3O3S2 — CID 70173925
(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]piperidine-3-carboxylic acid (PubChem CID 70173925) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70173925 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CCSc4nccs4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C24H29N3O3S2/c1-30-19-5-6-22-20(15-19)17(7-9-25-22)3-2-4-18-8-11-27(16-21(18)23(28)29)12-14-32-24-26-10-13-31-24/h5-7,9-10,13,15,18,21H,2-4,8,11-12,14,16H2,1H3,(H,28,29)/t18-,21+/m1/s1 |
| InChIKey | STMXBJUAURPKGT-NQIIRXRSSA-N |
| XLogP | 4.84 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|