C29H42N2O3S — CID 21346589
(3R,4R)-1-(3-cycloheptylsulfanylpropyl)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 21346589) has the molecular formula C29H42N2O3S and a molecular weight of 498.73 g/mol. Its IUPAC name is (3R,4R)-1-(3-cycloheptylsulfanylpropyl)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-(3-cycloheptylsulfanylpropyl)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 21346589 |
| Molecular Formula | C29H42N2O3S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | (3R,4R)-1-(3-cycloheptylsulfanylpropyl)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CCCSC4CCCCCC4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C29H42N2O3S/c1-34-24-12-13-28-26(20-24)22(14-16-30-28)8-6-9-23-15-18-31(21-27(23)29(32)33)17-7-19-35-25-10-4-2-3-5-11-25/h12-14,16,20,23,25,27H,2-11,15,17-19,21H2,1H3,(H,32,33)/t23-,27+/m1/s1 |
| InChIKey | AUPUZCZRZNOWHL-KCWPFWIISA-N |
| XLogP | 6.43 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|