C30H44N2O3S — CID 22454390
3-[1-(3-cyclohexylsulfanylpropyl)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 22454390) has the molecular formula C30H44N2O3S and a molecular weight of 512.76 g/mol. Its IUPAC name is 3-[1-(3-cyclohexylsulfanylpropyl)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-(3-cyclohexylsulfanylpropyl)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22454390 |
| Molecular Formula | C30H44N2O3S |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 3-[1-(3-cyclohexylsulfanylpropyl)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CCCSC4CCCCC4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H44N2O3S/c1-35-26-12-13-29-28(21-26)24(15-17-31-29)8-5-7-23-16-19-32(22-25(23)11-14-30(33)34)18-6-20-36-27-9-3-2-4-10-27/h12-13,15,17,21,23,25,27H,2-11,14,16,18-20,22H2,1H3,(H,33,34) |
| InChIKey | MCQYVGVVIWANBK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|