C28H36N2O3S2 — CID 22455023
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylsulfanylpropyl)piperidin-3-yl]propanoic acid (PubChem CID 22455023) has the molecular formula C28H36N2O3S2 and a molecular weight of 512.74 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylsulfanylpropyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylsulfanylpropyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22455023 |
| Molecular Formula | C28H36N2O3S2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylsulfanylpropyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CCCSc4cccs4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C28H36N2O3S2/c1-33-24-9-10-26-25(19-24)22(12-14-29-26)6-2-5-21-13-16-30(20-23(21)8-11-27(31)32)15-4-18-35-28-7-3-17-34-28/h3,7,9-10,12,14,17,19,21,23H,2,4-6,8,11,13,15-16,18,20H2,1H3,(H,31,32) |
| InChIKey | WBIUTKURRBWWAZ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|