C27H34N2O4S — CID 22453419
3-[1-[2-(furan-2-ylsulfanyl)ethyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 22453419) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is 3-[1-[2-(furan-2-ylsulfanyl)ethyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[2-(furan-2-ylsulfanyl)ethyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22453419 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 3-[1-[2-(furan-2-ylsulfanyl)ethyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CCSc4ccco4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C27H34N2O4S/c1-32-23-8-9-25-24(18-23)21(11-13-28-25)5-2-4-20-12-14-29(19-22(20)7-10-26(30)31)15-17-34-27-6-3-16-33-27/h3,6,8-9,11,13,16,18,20,22H,2,4-5,7,10,12,14-15,17,19H2,1H3,(H,30,31) |
| InChIKey | UNJQUBYMIVDYFX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |