C37H44N2O3 — CID 11387473
3-phenylpropyl (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylpropyl)piperidine-3-carboxylate (PubChem CID 11387473) has the molecular formula C37H44N2O3 and a molecular weight of 564.77 g/mol. Its IUPAC name is 3-phenylpropyl (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylpropyl)piperidine-3-carboxylate.
| Compound Name | 3-phenylpropyl (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylpropyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 11387473 |
| Molecular Formula | C37H44N2O3 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | 3-phenylpropyl (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylpropyl)piperidine-3-carboxylate |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CCCc4ccccc4)C[C@@H]3C(=O)OCCCc3ccccc3)c2c1 |
| InChI | InChI=1S/C37H44N2O3/c1-41-33-19-20-36-34(27-33)31(21-23-38-36)17-8-18-32-22-25-39(24-9-15-29-11-4-2-5-12-29)28-35(32)37(40)42-26-10-16-30-13-6-3-7-14-30/h2-7,11-14,19-21,23,27,32,35H,8-10,15-18,22,24-26,28H2,1H3/t32-,35+/m1/s1 |
| InChIKey | PYAGLCQEKBOWIU-LDNVYYCDSA-N |
| XLogP | 7.31 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|