C30H35F3N2O3S — CID 70173937
2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-[3-(trifluoromethyl)phenyl]sulfanylpropyl]piperidin-3-yl]acetic acid (PubChem CID 70173937) has the molecular formula C30H35F3N2O3S and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-[3-(trifluoromethyl)phenyl]sulfanylpropyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-[3-(trifluoromethyl)phenyl]sulfanylpropyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70173937 |
| Molecular Formula | C30H35F3N2O3S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-[3-(trifluoromethyl)phenyl]sulfanylpropyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CCCSc4cccc(C(F)(F)F)c4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C30H35F3N2O3S/c1-38-25-9-10-28-27(19-25)22(11-13-34-28)6-2-5-21-12-15-35(20-23(21)17-29(36)37)14-4-16-39-26-8-3-7-24(18-26)30(31,32)33/h3,7-11,13,18-19,21,23H,2,4-6,12,14-17,20H2,1H3,(H,36,37)/t21-,23+/m1/s1 |
| InChIKey | WVOIAEJUJITBOC-GGAORHGYSA-N |
| XLogP | 7.18 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|