C30H38N2O3S — CID 70174974
2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methylphenyl)sulfanylpropyl]piperidin-3-yl]acetic acid (PubChem CID 70174974) has the molecular formula C30H38N2O3S and a molecular weight of 506.71 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methylphenyl)sulfanylpropyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methylphenyl)sulfanylpropyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70174974 |
| Molecular Formula | C30H38N2O3S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methylphenyl)sulfanylpropyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CCCSc4cccc(C)c4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C30H38N2O3S/c1-22-6-3-9-27(18-22)36-17-5-15-32-16-13-23(25(21-32)19-30(33)34)7-4-8-24-12-14-31-29-11-10-26(35-2)20-28(24)29/h3,6,9-12,14,18,20,23,25H,4-5,7-8,13,15-17,19,21H2,1-2H3,(H,33,34)/t23-,25+/m1/s1 |
| InChIKey | ALIXOBKTVJJPGD-NOZRDPDXSA-N |
| XLogP | 6.47 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|