C30H36Cl2N2O4 — CID 70175037
2-[(3R,4R)-1-[4-(2,6-dichlorophenyl)butyl]-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid (PubChem CID 70175037) has the molecular formula C30H36Cl2N2O4 and a molecular weight of 559.53 g/mol. Its IUPAC name is 2-[(3R,4R)-1-[4-(2,6-dichlorophenyl)butyl]-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-1-[4-(2,6-dichlorophenyl)butyl]-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70175037 |
| Molecular Formula | C30H36Cl2N2O4 |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 2-[(3R,4R)-1-[4-(2,6-dichlorophenyl)butyl]-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CCC3CCN(CCCCc4c(Cl)cccc4Cl)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C30H36Cl2N2O4/c1-38-22-9-10-28-25(18-22)23(12-14-33-28)29(35)11-8-20-13-16-34(19-21(20)17-30(36)37)15-3-2-5-24-26(31)6-4-7-27(24)32/h4,6-7,9-10,12,14,18,20-21,29,35H,2-3,5,8,11,13,15-17,19H2,1H3,(H,36,37)/t20?,21-,29-/m0/s1 |
| InChIKey | QLVIBAYQOPODNV-IFTDKICYSA-N |
| XLogP | 6.80 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|