C27H34N2O4S — CID 70172894
(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-thiophen-3-ylbutyl)piperidine-3-carboxylic acid (PubChem CID 70172894) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-thiophen-3-ylbutyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-thiophen-3-ylbutyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70172894 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-thiophen-3-ylbutyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(O)CC[C@@H]3CCN(CCCCc4ccsc4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C27H34N2O4S/c1-33-21-6-7-25-23(16-21)22(9-12-28-25)26(30)8-5-20-10-14-29(17-24(20)27(31)32)13-3-2-4-19-11-15-34-18-19/h6-7,9,11-12,15-16,18,20,24,26,30H,2-5,8,10,13-14,17H2,1H3,(H,31,32)/t20-,24+,26?/m1/s1 |
| InChIKey | NCKFYJGZMSYASH-LLHWJCAFSA-N |
| XLogP | 5.16 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|