C28H32ClFN2O3S — CID 21346843
(3R,4R)-1-[3-(3-chlorophenyl)sulfanylpropyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 21346843) has the molecular formula C28H32ClFN2O3S and a molecular weight of 531.09 g/mol. Its IUPAC name is (3R,4R)-1-[3-(3-chlorophenyl)sulfanylpropyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[3-(3-chlorophenyl)sulfanylpropyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 21346843 |
| Molecular Formula | C28H32ClFN2O3S |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (3R,4R)-1-[3-(3-chlorophenyl)sulfanylpropyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCSc4cccc(Cl)c4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C28H32ClFN2O3S/c1-35-21-7-9-27-24(17-21)23(10-12-31-27)26(30)8-6-19-11-14-32(18-25(19)28(33)34)13-3-15-36-22-5-2-4-20(29)16-22/h2,4-5,7,9-10,12,16-17,19,25-26H,3,6,8,11,13-15,18H2,1H3,(H,33,34)/t19-,25+,26-/m1/s1 |
| InChIKey | XYHGFCUQRZBVKZ-JSRBVGTNSA-N |
| XLogP | 6.89 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|