C27H34N4O4S — CID 70175016
2-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-4-ylsulfanylpropyl)piperidin-3-yl]acetic acid (PubChem CID 70175016) has the molecular formula C27H34N4O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-4-ylsulfanylpropyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-4-ylsulfanylpropyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70175016 |
| Molecular Formula | C27H34N4O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-4-ylsulfanylpropyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(O)CCC3CCN(CCCSc4ccncn4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C27H34N4O4S/c1-35-21-4-5-24-23(16-21)22(7-11-29-24)25(32)6-3-19-9-13-31(17-20(19)15-27(33)34)12-2-14-36-26-8-10-28-18-30-26/h4-5,7-8,10-11,16,18-20,25,32H,2-3,6,9,12-15,17H2,1H3,(H,33,34)/t19?,20-,25?/m0/s1 |
| InChIKey | UNPQOWCZDXFCKR-CMAULLTDSA-N |
| XLogP | 4.44 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|