C23H31FN2O3S — CID 70176596
(3R,4R)-1-(2-ethylsulfanylethyl)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 70176596) has the molecular formula C23H31FN2O3S and a molecular weight of 434.58 g/mol. Its IUPAC name is (3R,4R)-1-(2-ethylsulfanylethyl)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-(2-ethylsulfanylethyl)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70176596 |
| Molecular Formula | C23H31FN2O3S |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (3R,4R)-1-(2-ethylsulfanylethyl)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | CCSCCN1CC[C@@H](CC[C@H](F)c2ccnc3ccc(OC)cc23)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C23H31FN2O3S/c1-3-30-13-12-26-11-9-16(20(15-26)23(27)28)4-6-21(24)18-8-10-25-22-7-5-17(29-2)14-19(18)22/h5,7-8,10,14,16,20-21H,3-4,6,9,11-13,15H2,1-2H3,(H,27,28)/t16-,20+,21+/m1/s1 |
| InChIKey | TXOFRLQNOMEYMI-CZAAIQMYSA-N |
| XLogP | 4.81 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|