C26H39N3O4 — CID 22386513
methyl 2-[4-heptyl-1-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperazin-2-yl]acetate (PubChem CID 22386513) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is methyl 2-[4-heptyl-1-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperazin-2-yl]acetate.
| Compound Name | methyl 2-[4-heptyl-1-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 22386513 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | methyl 2-[4-heptyl-1-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperazin-2-yl]acetate |
| SMILES | CCCCCCCN1CCN(CC(O)c2ccnc3ccc(OC)cc23)C(CC(=O)OC)C1 |
| InChI | InChI=1S/C26H39N3O4/c1-4-5-6-7-8-13-28-14-15-29(20(18-28)16-26(31)33-3)19-25(30)22-11-12-27-24-10-9-21(32-2)17-23(22)24/h9-12,17,20,25,30H,4-8,13-16,18-19H2,1-3H3 |
| InChIKey | HQDZBBJSVLEIGA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|