C27H39N3O2 — CID 57230362
2-[(3R,4R)-1-heptyl-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetonitrile (PubChem CID 57230362) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 2-[(3R,4R)-1-heptyl-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetonitrile.
| Compound Name | 2-[(3R,4R)-1-heptyl-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 57230362 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 2-[(3R,4R)-1-heptyl-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetonitrile |
| SMILES | CCCCCCCN1CCC(CC[C@@H](O)c2ccnc3ccc(OC)cc23)[C@@H](CC#N)C1 |
| InChI | InChI=1S/C27H39N3O2/c1-3-4-5-6-7-17-30-18-14-21(22(20-30)12-15-28)8-11-27(31)24-13-16-29-26-10-9-23(32-2)19-25(24)26/h9-10,13,16,19,21-22,27,31H,3-8,11-12,14,17-18,20H2,1-2H3/t21?,22-,27+/m0/s1 |
| InChIKey | FBRQLZHPMWBRTN-GYZHRQORSA-N |
| XLogP | 5.88 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|