C25H38N4O3 — CID 70132510
(2R,3R,4R)-4-(heptylamino)-2-[(2S)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidine-3-carboxamide (PubChem CID 70132510) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is (2R,3R,4R)-4-(heptylamino)-2-[(2S)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidine-3-carboxamide.
| Compound Name | (2R,3R,4R)-4-(heptylamino)-2-[(2S)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 70132510 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (2R,3R,4R)-4-(heptylamino)-2-[(2S)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidine-3-carboxamide |
| SMILES | CCCCCCCN[C@@H]1CCN[C@H](C[C@H](O)c2ccnc3ccc(OC)cc23)[C@@H]1C(N)=O |
| InChI | InChI=1S/C25H38N4O3/c1-3-4-5-6-7-12-27-21-11-14-29-22(24(21)25(26)31)16-23(30)18-10-13-28-20-9-8-17(32-2)15-19(18)20/h8-10,13,15,21-24,27,29-30H,3-7,11-12,14,16H2,1-2H3,(H2,26,31)/t21-,22-,23+,24-/m1/s1 |
| InChIKey | DCQLCFKUEFKGOF-JLLPCOHGSA-N |
| XLogP | 3.06 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|