C28H45N3O2 — CID 44534039
4-(diheptylamino)-N-(6-methoxyquinolin-4-yl)butanamide (PubChem CID 44534039) has the molecular formula C28H45N3O2 and a molecular weight of 455.69 g/mol. Its IUPAC name is 4-(diheptylamino)-N-(6-methoxyquinolin-4-yl)butanamide.
| Compound Name | 4-(diheptylamino)-N-(6-methoxyquinolin-4-yl)butanamide |
|---|---|
| PubChem CID | 44534039 |
| Molecular Formula | C28H45N3O2 |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 455.35 |
| IUPAC Name | 4-(diheptylamino)-N-(6-methoxyquinolin-4-yl)butanamide |
| SMILES | CCCCCCCN(CCCCCCC)CCCC(=O)Nc1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H45N3O2/c1-4-6-8-10-12-20-31(21-13-11-9-7-5-2)22-14-15-28(32)30-27-18-19-29-26-17-16-24(33-3)23-25(26)27/h16-19,23H,4-15,20-22H2,1-3H3,(H,29,30,32) |
| InChIKey | CQQCGQLEARGPIC-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|