C26H38N4O7 — CID 18177046
1-[1-heptyl-3-(hydroxymethyl)piperidin-4-yl]-3-(6-methoxyquinolin-4-yl)urea;oxalic acid (PubChem CID 18177046) has the molecular formula C26H38N4O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is 1-[1-heptyl-3-(hydroxymethyl)piperidin-4-yl]-3-(6-methoxyquinolin-4-yl)urea;oxalic acid.
| Compound Name | 1-[1-heptyl-3-(hydroxymethyl)piperidin-4-yl]-3-(6-methoxyquinolin-4-yl)urea;oxalic acid |
|---|---|
| PubChem CID | 18177046 |
| Molecular Formula | C26H38N4O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 1-[1-heptyl-3-(hydroxymethyl)piperidin-4-yl]-3-(6-methoxyquinolin-4-yl)urea;oxalic acid |
| SMILES | CCCCCCCN1CCC(NC(=O)Nc2ccnc3ccc(OC)cc23)C(CO)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H36N4O3.C2H2O4/c1-3-4-5-6-7-13-28-14-11-21(18(16-28)17-29)26-24(30)27-23-10-12-25-22-9-8-19(31-2)15-20(22)23;3-1(4)2(5)6/h8-10,12,15,18,21,29H,3-7,11,13-14,16-17H2,1-2H3,(H2,25,26,27,30);(H,3,4)(H,5,6) |
| InChIKey | HYKFTCSGOIOBSK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 161.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|