C26H30N4O3S — CID 87801455
6-[[[1-[(2S)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]methyl]-3-methyl-1,3-benzoxazole-2-thione (PubChem CID 87801455) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is 6-[[[1-[(2S)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]methyl]-3-methyl-1,3-benzoxazole-2-thione.
| Compound Name | 6-[[[1-[(2S)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]methyl]-3-methyl-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 87801455 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 6-[[[1-[(2S)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]methyl]-3-methyl-1,3-benzoxazole-2-thione |
| SMILES | COc1ccc2nccc([C@H](O)CN3CCC(NCc4ccc5c(c4)oc(=S)n5C)CC3)c2c1 |
| InChI | InChI=1S/C26H30N4O3S/c1-29-23-6-3-17(13-25(23)33-26(29)34)15-28-18-8-11-30(12-9-18)16-24(31)20-7-10-27-22-5-4-19(32-2)14-21(20)22/h3-7,10,13-14,18,24,28,31H,8-9,11-12,15-16H2,1-2H3/t24-/m1/s1 |
| InChIKey | GNWHDFGJPRKJTC-XMMPIXPASA-N |
| XLogP | 4.35 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|