C25H30N4O5 — CID 44535118
(1R)-1-(6-methoxyquinolin-4-yl)-2-[4-[2-(2-nitrophenoxy)ethylamino]piperidin-1-yl]ethanol (PubChem CID 44535118) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-[2-(2-nitrophenoxy)ethylamino]piperidin-1-yl]ethanol.
| Compound Name | (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-[2-(2-nitrophenoxy)ethylamino]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 44535118 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-[2-(2-nitrophenoxy)ethylamino]piperidin-1-yl]ethanol |
| SMILES | COc1ccc2nccc([C@@H](O)CN3CCC(NCCOc4ccccc4[N+](=O)[O-])CC3)c2c1 |
| InChI | InChI=1S/C25H30N4O5/c1-33-19-6-7-22-21(16-19)20(8-11-27-22)24(30)17-28-13-9-18(10-14-28)26-12-15-34-25-5-3-2-4-23(25)29(31)32/h2-8,11,16,18,24,26,30H,9-10,12-15,17H2,1H3/t24-/m0/s1 |
| InChIKey | KZJFLPITQIUVOD-DEOSSOPVSA-N |
| XLogP | 3.32 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|