C30H33N3O11 — CID 131737682
(E)-1-[4-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperazin-1-yl]-4-phenylbut-3-en-1-one;oxalic acid (PubChem CID 131737682) has the molecular formula C30H33N3O11 and a molecular weight of 611.60 g/mol. Its IUPAC name is (E)-1-[4-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperazin-1-yl]-4-phenylbut-3-en-1-one;oxalic acid.
| Compound Name | (E)-1-[4-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperazin-1-yl]-4-phenylbut-3-en-1-one;oxalic acid |
|---|---|
| PubChem CID | 131737682 |
| Molecular Formula | C30H33N3O11 |
| Molecular Weight | 611.60 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | (E)-1-[4-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperazin-1-yl]-4-phenylbut-3-en-1-one;oxalic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CN3CCN(C(=O)C/C=C/c4ccccc4)CC3)c2c1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H29N3O3.2C2H2O4/c1-32-21-10-11-24-23(18-21)22(12-13-27-24)25(30)19-28-14-16-29(17-15-28)26(31)9-5-8-20-6-3-2-4-7-20;2*3-1(4)2(5)6/h2-8,10-13,18,25,30H,9,14-17,19H2,1H3;2*(H,3,4)(H,5,6)/b8-5+;;/t25-;;/m0../s1 |
| InChIKey | PWKATFBVFCUPEP-DPMMLBNDSA-N |
| XLogP | 1.84 |
| TPSA | 215.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.60 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|