C26H34N4O — CID 10180321
(1S)-1-(6-methoxyquinolin-4-yl)-2-[4-(4-phenylbutyl)piperazin-1-yl]ethanamine (PubChem CID 10180321) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is (1S)-1-(6-methoxyquinolin-4-yl)-2-[4-(4-phenylbutyl)piperazin-1-yl]ethanamine.
| Compound Name | (1S)-1-(6-methoxyquinolin-4-yl)-2-[4-(4-phenylbutyl)piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 10180321 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (1S)-1-(6-methoxyquinolin-4-yl)-2-[4-(4-phenylbutyl)piperazin-1-yl]ethanamine |
| SMILES | COc1ccc2nccc([C@H](N)CN3CCN(CCCCc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C26H34N4O/c1-31-22-10-11-26-24(19-22)23(12-13-28-26)25(27)20-30-17-15-29(16-18-30)14-6-5-9-21-7-3-2-4-8-21/h2-4,7-8,10-13,19,25H,5-6,9,14-18,20,27H2,1H3/t25-/m1/s1 |
| InChIKey | YVRPSYGTAYSEMX-RUZDIDTESA-N |
| XLogP | 3.88 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|