C27H27NO6 — CID 11202040
benzyl (3S,5S,6R)-3-(dimethoxymethyl)-2-oxo-5,6-diphenylmorpholine-4-carboxylate (PubChem CID 11202040) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is benzyl (3S,5S,6R)-3-(dimethoxymethyl)-2-oxo-5,6-diphenylmorpholine-4-carboxylate.
| Compound Name | benzyl (3S,5S,6R)-3-(dimethoxymethyl)-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 11202040 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | benzyl (3S,5S,6R)-3-(dimethoxymethyl)-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
| SMILES | COC(OC)[C@H]1C(=O)O[C@H](c2ccccc2)[C@H](c2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H27NO6/c1-31-26(32-2)23-25(29)34-24(21-16-10-5-11-17-21)22(20-14-8-4-9-15-20)28(23)27(30)33-18-19-12-6-3-7-13-19/h3-17,22-24,26H,18H2,1-2H3/t22-,23+,24+/m0/s1 |
| InChIKey | YBHHHAVFHGJONY-RBZQAINGSA-N |
| XLogP | 4.65 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|