C15H17IO4 — CID 102396508
ethyl (1R,2S,4R,5S)-2-hydroxy-5-iodo-2-methyl-4-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 102396508) has the molecular formula C15H17IO4 and a molecular weight of 388.20 g/mol. Its IUPAC name is ethyl (1R,2S,4R,5S)-2-hydroxy-5-iodo-2-methyl-4-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | ethyl (1R,2S,4R,5S)-2-hydroxy-5-iodo-2-methyl-4-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 102396508 |
| Molecular Formula | C15H17IO4 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | ethyl (1R,2S,4R,5S)-2-hydroxy-5-iodo-2-methyl-4-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@@]1(I)[C@@H](c1ccccc1)O[C@]2(C)O |
| InChI | InChI=1S/C15H17IO4/c1-3-19-12(17)14-9-15(14,16)11(20-13(14,2)18)10-7-5-4-6-8-10/h4-8,11,18H,3,9H2,1-2H3/t11-,13+,14+,15-/m1/s1 |
| InChIKey | NTNLRWUBCPMBIK-UQOMUDLDSA-N |
| XLogP | 2.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|