C25H25ClO5 — CID 102201551
diethyl (2R,5S)-2-(4-chlorophenyl)-5-methyl-5-(2-phenylethynyl)oxolane-3,3-dicarboxylate (PubChem CID 102201551) has the molecular formula C25H25ClO5 and a molecular weight of 440.92 g/mol. Its IUPAC name is diethyl (2R,5S)-2-(4-chlorophenyl)-5-methyl-5-(2-phenylethynyl)oxolane-3,3-dicarboxylate.
| Compound Name | diethyl (2R,5S)-2-(4-chlorophenyl)-5-methyl-5-(2-phenylethynyl)oxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102201551 |
| Molecular Formula | C25H25ClO5 |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | diethyl (2R,5S)-2-(4-chlorophenyl)-5-methyl-5-(2-phenylethynyl)oxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@](C)(C#Cc2ccccc2)O[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClO5/c1-4-29-22(27)25(23(28)30-5-2)17-24(3,16-15-18-9-7-6-8-10-18)31-21(25)19-11-13-20(26)14-12-19/h6-14,21H,4-5,17H2,1-3H3/t21-,24-/m1/s1 |
| InChIKey | IDXZNODIGLDQOK-ZJSXRUAMSA-N |
| XLogP | 4.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|