C28H28ClNO7S — CID 175667876
diethyl (2R,5S)-5-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyl-2-phenyl-1,3-oxazolidine-4,4-dicarboxylate (PubChem CID 175667876) has the molecular formula C28H28ClNO7S and a molecular weight of 558.05 g/mol. Its IUPAC name is diethyl (2R,5S)-5-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyl-2-phenyl-1,3-oxazolidine-4,4-dicarboxylate.
| Compound Name | diethyl (2R,5S)-5-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyl-2-phenyl-1,3-oxazolidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 175667876 |
| Molecular Formula | C28H28ClNO7S |
| Molecular Weight | 558.05 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | diethyl (2R,5S)-5-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyl-2-phenyl-1,3-oxazolidine-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](c2ccc(Cl)cc2)O[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H28ClNO7S/c1-4-35-26(31)28(27(32)36-5-2)24(20-13-15-22(29)16-14-20)37-25(21-9-7-6-8-10-21)30(28)38(33,34)23-17-11-19(3)12-18-23/h6-18,24-25H,4-5H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | PHZXXIJUHSQRPA-LOSJGSFVSA-N |
| XLogP | 4.97 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|