C26H25NO7S — CID 132522758
dimethyl (2R,5S)-3-(4-methylphenyl)sulfonyl-2,5-diphenyl-1,3-oxazolidine-4,4-dicarboxylate (PubChem CID 132522758) has the molecular formula C26H25NO7S and a molecular weight of 495.55 g/mol. Its IUPAC name is dimethyl (2R,5S)-3-(4-methylphenyl)sulfonyl-2,5-diphenyl-1,3-oxazolidine-4,4-dicarboxylate.
| Compound Name | dimethyl (2R,5S)-3-(4-methylphenyl)sulfonyl-2,5-diphenyl-1,3-oxazolidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 132522758 |
| Molecular Formula | C26H25NO7S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | dimethyl (2R,5S)-3-(4-methylphenyl)sulfonyl-2,5-diphenyl-1,3-oxazolidine-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@H](c2ccccc2)O[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H25NO7S/c1-18-14-16-21(17-15-18)35(30,31)27-23(20-12-8-5-9-13-20)34-22(19-10-6-4-7-11-19)26(27,24(28)32-2)25(29)33-3/h4-17,22-23H,1-3H3/t22-,23+/m0/s1 |
| InChIKey | YDBTYPWEMXURGN-XZOQPEGZSA-N |
| XLogP | 3.54 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|