C16H19NO7S — CID 102129986
dimethyl (3S)-3-methyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 102129986) has the molecular formula C16H19NO7S and a molecular weight of 369.40 g/mol. Its IUPAC name is dimethyl (3S)-3-methyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | dimethyl (3S)-3-methyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102129986 |
| Molecular Formula | C16H19NO7S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | dimethyl (3S)-3-methyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](C)CC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO7S/c1-10-5-7-12(8-6-10)25(21,22)17-13(18)9-11(2)16(17,14(19)23-3)15(20)24-4/h5-8,11H,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | IMKQEWIFOFUANR-NSHDSACASA-N |
| XLogP | 0.64 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|