C20H27NO5S — CID 177434573
methyl 2-[(3S)-1-(4-methylphenyl)sulfonyl-2-oxo-1-azaspiro[4.6]undecan-3-yl]acetate (PubChem CID 177434573) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is methyl 2-[(3S)-1-(4-methylphenyl)sulfonyl-2-oxo-1-azaspiro[4.6]undecan-3-yl]acetate.
| Compound Name | methyl 2-[(3S)-1-(4-methylphenyl)sulfonyl-2-oxo-1-azaspiro[4.6]undecan-3-yl]acetate |
|---|---|
| PubChem CID | 177434573 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | methyl 2-[(3S)-1-(4-methylphenyl)sulfonyl-2-oxo-1-azaspiro[4.6]undecan-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC2(CCCCCC2)N(S(=O)(=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C20H27NO5S/c1-15-7-9-17(10-8-15)27(24,25)21-19(23)16(13-18(22)26-2)14-20(21)11-5-3-4-6-12-20/h7-10,16H,3-6,11-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | FDIDZQSHPVISIJ-MRXNPFEDSA-N |
| XLogP | 3.19 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |