C18H23NO6S — CID 177217604
methyl 2-[2-(4-methylphenyl)sulfonyl-1-oxo-8-oxa-2-azaspiro[4.5]decan-3-yl]acetate (PubChem CID 177217604) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl 2-[2-(4-methylphenyl)sulfonyl-1-oxo-8-oxa-2-azaspiro[4.5]decan-3-yl]acetate.
| Compound Name | methyl 2-[2-(4-methylphenyl)sulfonyl-1-oxo-8-oxa-2-azaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 177217604 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | methyl 2-[2-(4-methylphenyl)sulfonyl-1-oxo-8-oxa-2-azaspiro[4.5]decan-3-yl]acetate |
| SMILES | COC(=O)CC1CC2(CCOCC2)C(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO6S/c1-13-3-5-15(6-4-13)26(22,23)19-14(11-16(20)24-2)12-18(17(19)21)7-9-25-10-8-18/h3-6,14H,7-12H2,1-2H3 |
| InChIKey | VLCCOCOIBOWNRQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |