C18H23NO5S — CID 177217711
methyl 2-[2-(4-methylphenyl)sulfonyl-3-oxo-2-azaspiro[4.4]nonan-1-yl]acetate (PubChem CID 177217711) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is methyl 2-[2-(4-methylphenyl)sulfonyl-3-oxo-2-azaspiro[4.4]nonan-1-yl]acetate.
| Compound Name | methyl 2-[2-(4-methylphenyl)sulfonyl-3-oxo-2-azaspiro[4.4]nonan-1-yl]acetate |
|---|---|
| PubChem CID | 177217711 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl 2-[2-(4-methylphenyl)sulfonyl-3-oxo-2-azaspiro[4.4]nonan-1-yl]acetate |
| SMILES | COC(=O)CC1N(S(=O)(=O)c2ccc(C)cc2)C(=O)CC12CCCC2 |
| InChI | InChI=1S/C18H23NO5S/c1-13-5-7-14(8-6-13)25(22,23)19-15(11-17(21)24-2)18(12-16(19)20)9-3-4-10-18/h5-8,15H,3-4,9-12H2,1-2H3 |
| InChIKey | ZNYCQCZAESZLEA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |