C26H25NO5S — CID 134854079
methyl 3-benzyl-1-(4-methylphenyl)sulfonyl-5-oxo-2-phenylpyrrolidine-3-carboxylate (PubChem CID 134854079) has the molecular formula C26H25NO5S and a molecular weight of 463.56 g/mol. Its IUPAC name is methyl 3-benzyl-1-(4-methylphenyl)sulfonyl-5-oxo-2-phenylpyrrolidine-3-carboxylate.
| Compound Name | methyl 3-benzyl-1-(4-methylphenyl)sulfonyl-5-oxo-2-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 134854079 |
| Molecular Formula | C26H25NO5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | methyl 3-benzyl-1-(4-methylphenyl)sulfonyl-5-oxo-2-phenylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1(Cc2ccccc2)CC(=O)N(S(=O)(=O)c2ccc(C)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C26H25NO5S/c1-19-13-15-22(16-14-19)33(30,31)27-23(28)18-26(25(29)32-2,17-20-9-5-3-6-10-20)24(27)21-11-7-4-8-12-21/h3-16,24H,17-18H2,1-2H3 |
| InChIKey | LQOFEXFBBBLUQE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |