C22H26INO4S — CID 101398730
methyl (2R,4S)-2-benzyl-4-iodo-5,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 101398730) has the molecular formula C22H26INO4S and a molecular weight of 527.42 g/mol. Its IUPAC name is methyl (2R,4S)-2-benzyl-4-iodo-5,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,4S)-2-benzyl-4-iodo-5,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 101398730 |
| Molecular Formula | C22H26INO4S |
| Molecular Weight | 527.42 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | methyl (2R,4S)-2-benzyl-4-iodo-5,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccccc2)C[C@H](I)C(C)(C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26INO4S/c1-16-10-12-18(13-11-16)29(26,27)24-21(2,3)19(23)15-22(24,20(25)28-4)14-17-8-6-5-7-9-17/h5-13,19H,14-15H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | PKIHWRAXDNHWDB-SIKLNZKXSA-N |
| XLogP | 4.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|