C21H24N2O4S — CID 129319543
benzyl N-[2-(4-methylphenyl)sulfonyl-2-azaspiro[3.3]heptan-6-yl]carbamate (PubChem CID 129319543) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is benzyl N-[2-(4-methylphenyl)sulfonyl-2-azaspiro[3.3]heptan-6-yl]carbamate.
| Compound Name | benzyl N-[2-(4-methylphenyl)sulfonyl-2-azaspiro[3.3]heptan-6-yl]carbamate |
|---|---|
| PubChem CID | 129319543 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | benzyl N-[2-(4-methylphenyl)sulfonyl-2-azaspiro[3.3]heptan-6-yl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3(CC(NC(=O)OCc4ccccc4)C3)C2)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-16-7-9-19(10-8-16)28(25,26)23-14-21(15-23)11-18(12-21)22-20(24)27-13-17-5-3-2-4-6-17/h2-10,18H,11-15H2,1H3,(H,22,24) |
| InChIKey | AZRSXGXQFQOFQV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |