C13H18N4O3 — CID 163966930
benzyl N-[3-[(aminodiazenyl)methyl]-3-hydroxycyclobutyl]carbamate (PubChem CID 163966930) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is benzyl N-[3-[(aminodiazenyl)methyl]-3-hydroxycyclobutyl]carbamate.
| Compound Name | benzyl N-[3-[(aminodiazenyl)methyl]-3-hydroxycyclobutyl]carbamate |
|---|---|
| PubChem CID | 163966930 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | benzyl N-[3-[(aminodiazenyl)methyl]-3-hydroxycyclobutyl]carbamate |
| SMILES | N/N=N/CC1(O)CC(NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C13H18N4O3/c14-17-15-9-13(19)6-11(7-13)16-12(18)20-8-10-4-2-1-3-5-10/h1-5,11,19H,6-9H2,(H2,14,15)(H,16,18) |
| InChIKey | SRMZQHARHHTPDU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|