C13H16F2N2O2 — CID 124556141
benzyl N-[(3R)-5,5-difluoropiperidin-3-yl]carbamate (PubChem CID 124556141) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is benzyl N-[(3R)-5,5-difluoropiperidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3R)-5,5-difluoropiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 124556141 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | benzyl N-[(3R)-5,5-difluoropiperidin-3-yl]carbamate |
| SMILES | O=C(N[C@H]1CNCC(F)(F)C1)OCc1ccccc1 |
| InChI | InChI=1S/C13H16F2N2O2/c14-13(15)6-11(7-16-9-13)17-12(18)19-8-10-4-2-1-3-5-10/h1-5,11,16H,6-9H2,(H,17,18)/t11-/m1/s1 |
| InChIKey | YEBTXCZKAQRPMH-LLVKDONJSA-N |
| XLogP | 1.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |