C18H24F4N2O4 — CID 159212303
benzyl N-(5,5-difluorooxan-3-yl)carbamate;5,5-difluorooxan-3-amine (PubChem CID 159212303) has the molecular formula C18H24F4N2O4 and a molecular weight of 408.39 g/mol. Its IUPAC name is benzyl N-(5,5-difluorooxan-3-yl)carbamate;5,5-difluorooxan-3-amine.
| Compound Name | benzyl N-(5,5-difluorooxan-3-yl)carbamate;5,5-difluorooxan-3-amine |
|---|---|
| PubChem CID | 159212303 |
| Molecular Formula | C18H24F4N2O4 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | benzyl N-(5,5-difluorooxan-3-yl)carbamate;5,5-difluorooxan-3-amine |
| SMILES | NC1COCC(F)(F)C1.O=C(NC1COCC(F)(F)C1)OCc1ccccc1 |
| InChI | InChI=1S/C13H15F2NO3.C5H9F2NO/c14-13(15)6-11(8-18-9-13)16-12(17)19-7-10-4-2-1-3-5-10;6-5(7)1-4(8)2-9-3-5/h1-5,11H,6-9H2,(H,16,17);4H,1-3,8H2 |
| InChIKey | KQQHYWLXFGMRHE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |