C22H25NO5S — CID 177407963
methyl (E)-3-[(2S,4S,5R)-4-methyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidin-2-yl]but-2-enoate (PubChem CID 177407963) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is methyl (E)-3-[(2S,4S,5R)-4-methyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidin-2-yl]but-2-enoate.
| Compound Name | methyl (E)-3-[(2S,4S,5R)-4-methyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidin-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 177407963 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | methyl (E)-3-[(2S,4S,5R)-4-methyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidin-2-yl]but-2-enoate |
| SMILES | COC(=O)/C=C(\C)[C@@H]1O[C@H](c2ccccc2)[C@H](C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H25NO5S/c1-15-10-12-19(13-11-15)29(25,26)23-17(3)21(18-8-6-5-7-9-18)28-22(23)16(2)14-20(24)27-4/h5-14,17,21-22H,1-4H3/b16-14+/t17-,21-,22-/m0/s1 |
| InChIKey | HMJOPQAPHJVKNH-BLPSAVNVSA-N |
| XLogP | 3.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|