C22H22NO4PS — CID 90152202
4-methyl-3-(4-methylphenyl)sulfonyl-2,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 90152202) has the molecular formula C22H22NO4PS and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-methyl-3-(4-methylphenyl)sulfonyl-2,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | 4-methyl-3-(4-methylphenyl)sulfonyl-2,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 90152202 |
| Molecular Formula | C22H22NO4PS |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-methyl-3-(4-methylphenyl)sulfonyl-2,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | Cc1ccc(S(=O)(=O)N2C(C)C(c3ccccc3)OP2(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22NO4PS/c1-17-13-15-21(16-14-17)29(25,26)23-18(2)22(19-9-5-3-6-10-19)27-28(23,24)20-11-7-4-8-12-20/h3-16,18,22H,1-2H3 |
| InChIKey | BWDDGXLZABUOAQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|