C16H18NO4PS — CID 11674712
3-(4-methylphenyl)sulfonyl-2-phenyl-1,3,2lambda5-oxazaphosphinane 2-oxide (PubChem CID 11674712) has the molecular formula C16H18NO4PS and a molecular weight of 351.36 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-2-phenyl-1,3,2lambda5-oxazaphosphinane 2-oxide.
| Compound Name | 3-(4-methylphenyl)sulfonyl-2-phenyl-1,3,2lambda5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 11674712 |
| Molecular Formula | C16H18NO4PS |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-2-phenyl-1,3,2lambda5-oxazaphosphinane 2-oxide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCOP2(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18NO4PS/c1-14-8-10-16(11-9-14)23(19,20)17-12-5-13-21-22(17,18)15-6-3-2-4-7-15/h2-4,6-11H,5,12-13H2,1H3 |
| InChIKey | IRFBHNVTCWUKCQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|