C22H25NO6S — CID 101468739
diethyl 3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridine-2,2-dicarboxylate (PubChem CID 101468739) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is diethyl 3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridine-2,2-dicarboxylate.
| Compound Name | diethyl 3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101468739 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | diethyl 3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(c2ccc(C)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H25NO6S/c1-5-28-20(24)22(21(25)29-6-2)19(17-11-7-15(3)8-12-17)23(22)30(26,27)18-13-9-16(4)10-14-18/h7-14,19H,5-6H2,1-4H3 |
| InChIKey | XIOWLWIHGNMRRT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|