C36H37BrN2O6S — CID 102290088
dimethyl (2S,5R)-1-benzyl-2-(4-bromophenyl)-3-(4-methylphenyl)sulfonyl-5-(4-propan-2-ylphenyl)imidazolidine-4,4-dicarboxylate (PubChem CID 102290088) has the molecular formula C36H37BrN2O6S and a molecular weight of 705.67 g/mol. Its IUPAC name is dimethyl (2S,5R)-1-benzyl-2-(4-bromophenyl)-3-(4-methylphenyl)sulfonyl-5-(4-propan-2-ylphenyl)imidazolidine-4,4-dicarboxylate.
| Compound Name | dimethyl (2S,5R)-1-benzyl-2-(4-bromophenyl)-3-(4-methylphenyl)sulfonyl-5-(4-propan-2-ylphenyl)imidazolidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 102290088 |
| Molecular Formula | C36H37BrN2O6S |
| Molecular Weight | 705.67 g/mol |
| Exact Mass | 704.16 |
| IUPAC Name | dimethyl (2S,5R)-1-benzyl-2-(4-bromophenyl)-3-(4-methylphenyl)sulfonyl-5-(4-propan-2-ylphenyl)imidazolidine-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](c2ccc(C(C)C)cc2)N(Cc2ccccc2)[C@H](c2ccc(Br)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C36H37BrN2O6S/c1-24(2)27-13-15-28(16-14-27)32-36(34(40)44-4,35(41)45-5)39(46(42,43)31-21-11-25(3)12-22-31)33(29-17-19-30(37)20-18-29)38(32)23-26-9-7-6-8-10-26/h6-22,24,32-33H,23H2,1-5H3/t32-,33+/m1/s1 |
| InChIKey | GIBUIEIUXBXIEO-SAIUNTKASA-N |
| XLogP | 6.91 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|