C21H18Br2N2O2S — CID 71623166
(3S)-1-benzyl-3-(3,5-dibromophenyl)-2-(4-methylphenyl)sulfonyldiaziridine (PubChem CID 71623166) has the molecular formula C21H18Br2N2O2S and a molecular weight of 522.26 g/mol. Its IUPAC name is (3S)-1-benzyl-3-(3,5-dibromophenyl)-2-(4-methylphenyl)sulfonyldiaziridine.
| Compound Name | (3S)-1-benzyl-3-(3,5-dibromophenyl)-2-(4-methylphenyl)sulfonyldiaziridine |
|---|---|
| PubChem CID | 71623166 |
| Molecular Formula | C21H18Br2N2O2S |
| Molecular Weight | 522.26 g/mol |
| Exact Mass | 519.95 |
| IUPAC Name | (3S)-1-benzyl-3-(3,5-dibromophenyl)-2-(4-methylphenyl)sulfonyldiaziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](c3cc(Br)cc(Br)c3)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18Br2N2O2S/c1-15-7-9-20(10-8-15)28(26,27)25-21(17-11-18(22)13-19(23)12-17)24(25)14-16-5-3-2-4-6-16/h2-13,21H,14H2,1H3/t21-,24?,25?/m0/s1 |
| InChIKey | CGQKEBDAXLIRBV-ANYOXOOPSA-N |
| XLogP | 5.64 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.26 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|