C31H29BrN2O2S — CID 72501052
3-benzyl-7-bromo-2-(4-methylphenyl)sulfonyl-9-phenyl-1,3,3a,4,9,9a-hexahydropyrrolo[3,4-b]quinoline (PubChem CID 72501052) has the molecular formula C31H29BrN2O2S and a molecular weight of 573.56 g/mol. Its IUPAC name is 3-benzyl-7-bromo-2-(4-methylphenyl)sulfonyl-9-phenyl-1,3,3a,4,9,9a-hexahydropyrrolo[3,4-b]quinoline.
| Compound Name | 3-benzyl-7-bromo-2-(4-methylphenyl)sulfonyl-9-phenyl-1,3,3a,4,9,9a-hexahydropyrrolo[3,4-b]quinoline |
|---|---|
| PubChem CID | 72501052 |
| Molecular Formula | C31H29BrN2O2S |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | 3-benzyl-7-bromo-2-(4-methylphenyl)sulfonyl-9-phenyl-1,3,3a,4,9,9a-hexahydropyrrolo[3,4-b]quinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3C(c4ccccc4)c4cc(Br)ccc4NC3C2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H29BrN2O2S/c1-21-12-15-25(16-13-21)37(35,36)34-20-27-30(23-10-6-3-7-11-23)26-19-24(32)14-17-28(26)33-31(27)29(34)18-22-8-4-2-5-9-22/h2-17,19,27,29-31,33H,18,20H2,1H3 |
| InChIKey | OFOMODUGPFBYMO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |