C30H29NO2S — CID 102221375
2-benzyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine (PubChem CID 102221375) has the molecular formula C30H29NO2S and a molecular weight of 467.63 g/mol. Its IUPAC name is 2-benzyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine.
| Compound Name | 2-benzyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine |
|---|---|
| PubChem CID | 102221375 |
| Molecular Formula | C30H29NO2S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-benzyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)(c3ccccc3)CC2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29NO2S/c1-24-17-19-29(20-18-24)34(32,33)31-23-30(26-13-7-3-8-14-26,27-15-9-4-10-16-27)22-28(31)21-25-11-5-2-6-12-25/h2-20,28H,21-23H2,1H3 |
| InChIKey | AYSBHMFRBOQBBX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |