C25H25NO2S — CID 77140020
2-ethenyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine (PubChem CID 77140020) has the molecular formula C25H25NO2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 2-ethenyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine.
| Compound Name | 2-ethenyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine |
|---|---|
| PubChem CID | 77140020 |
| Molecular Formula | C25H25NO2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-ethenyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine |
| SMILES | C=CC1CC(c2ccccc2)(c2ccccc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25NO2S/c1-3-23-18-25(21-10-6-4-7-11-21,22-12-8-5-9-13-22)19-26(23)29(27,28)24-16-14-20(2)15-17-24/h3-17,23H,1,18-19H2,2H3 |
| InChIKey | CVKKWFRSKROGGF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|