C26H29NO2S — CID 134848112
(2R)-1-(4-methylphenyl)sulfonyl-4,4-diphenyl-2-propan-2-ylpyrrolidine (PubChem CID 134848112) has the molecular formula C26H29NO2S and a molecular weight of 419.59 g/mol. Its IUPAC name is (2R)-1-(4-methylphenyl)sulfonyl-4,4-diphenyl-2-propan-2-ylpyrrolidine.
| Compound Name | (2R)-1-(4-methylphenyl)sulfonyl-4,4-diphenyl-2-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 134848112 |
| Molecular Formula | C26H29NO2S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (2R)-1-(4-methylphenyl)sulfonyl-4,4-diphenyl-2-propan-2-ylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)(c3ccccc3)C[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C26H29NO2S/c1-20(2)25-18-26(22-10-6-4-7-11-22,23-12-8-5-9-13-23)19-27(25)30(28,29)24-16-14-21(3)15-17-24/h4-17,20,25H,18-19H2,1-3H3/t25-/m1/s1 |
| InChIKey | MJRXOLQBYZMVJE-RUZDIDTESA-N |
| XLogP | 5.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |