About 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine
1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine (PubChem CID 82251759) has the molecular formula C15H24N2O2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine |
| PubChem CID | 82251759 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine |
| SMILES | CC(C)C1CNC(C)(C)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O2S/c1-12(2)14-10-16-15(3,4)11-17(14)20(18,19)13-8-6-5-7-9-13/h5-9,12,14,16H,10-11H2,1-4H3 |
| InChIKey | NJEGLHXGSJAXEN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine?
The IUPAC name of 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine (CID 82251759) is 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine.
What is the SMILES notation for 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine?
The canonical SMILES for 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine is CC(C)C1CNC(C)(C)CN1S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine?
The InChIKey is NJEGLHXGSJAXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2S/c1-12(2)14-10-16-15(3,4)11-17(14)20(18,19)13-8-6-5-7-9-13/h5-9,12,14,16H,10-11H2,1-4H3.
What are the key properties of 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine?
1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine has a molecular weight of 296.44 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-5,5-dimethyl-2-propan-2-ylpiperazine is sourced from PubChem (CID 82251759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).