C27H27NO2S — CID 101469434
(3aS,7aS)-1-(4-methylphenyl)sulfonyl-3,3-diphenyl-3a,4,5,7a-tetrahydro-2H-indole (PubChem CID 101469434) has the molecular formula C27H27NO2S and a molecular weight of 429.59 g/mol. Its IUPAC name is (3aS,7aS)-1-(4-methylphenyl)sulfonyl-3,3-diphenyl-3a,4,5,7a-tetrahydro-2H-indole.
| Compound Name | (3aS,7aS)-1-(4-methylphenyl)sulfonyl-3,3-diphenyl-3a,4,5,7a-tetrahydro-2H-indole |
|---|---|
| PubChem CID | 101469434 |
| Molecular Formula | C27H27NO2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (3aS,7aS)-1-(4-methylphenyl)sulfonyl-3,3-diphenyl-3a,4,5,7a-tetrahydro-2H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)(c3ccccc3)[C@@H]3CCC=C[C@@H]32)cc1 |
| InChI | InChI=1S/C27H27NO2S/c1-21-16-18-24(19-17-21)31(29,30)28-20-27(22-10-4-2-5-11-22,23-12-6-3-7-13-23)25-14-8-9-15-26(25)28/h2-7,9-13,15-19,25-26H,8,14,20H2,1H3/t25-,26+/m1/s1 |
| InChIKey | PRENJFMRIHEGEQ-FTJBHMTQSA-N |
| XLogP | 5.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|