C28H29BrN2O2S2 — CID 102390950
(2R,3S,6R,11S)-3-benzyl-11-(4-bromophenyl)-4-(4-methylphenyl)sulfonyl-10-thia-1,4-diazatricyclo[6.3.0.02,6]undecane (PubChem CID 102390950) has the molecular formula C28H29BrN2O2S2 and a molecular weight of 569.59 g/mol. Its IUPAC name is (2R,3S,6R,11S)-3-benzyl-11-(4-bromophenyl)-4-(4-methylphenyl)sulfonyl-10-thia-1,4-diazatricyclo[6.3.0.02,6]undecane.
| Compound Name | (2R,3S,6R,11S)-3-benzyl-11-(4-bromophenyl)-4-(4-methylphenyl)sulfonyl-10-thia-1,4-diazatricyclo[6.3.0.02,6]undecane |
|---|---|
| PubChem CID | 102390950 |
| Molecular Formula | C28H29BrN2O2S2 |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | (2R,3S,6R,11S)-3-benzyl-11-(4-bromophenyl)-4-(4-methylphenyl)sulfonyl-10-thia-1,4-diazatricyclo[6.3.0.02,6]undecane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3CC4CS[C@@H](c5ccc(Br)cc5)N4[C@H]3[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H29BrN2O2S2/c1-19-7-13-25(14-8-19)35(32,33)30-17-22-16-24-18-34-28(21-9-11-23(29)12-10-21)31(24)27(22)26(30)15-20-5-3-2-4-6-20/h2-14,22,24,26-28H,15-18H2,1H3/t22-,24?,26+,27-,28+/m1/s1 |
| InChIKey | USIDPCCZGSBNGU-KASBMFSWSA-N |
| XLogP | 5.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |